C48H34N2O — CID 135234015
2-[(1R)-cyclohexa-2,4-dien-1-yl]-4-[8-(4-phenanthren-2-ylphenyl)dibenzofuran-1-yl]-6-phenyl-1,4-dihydropyrimidine (PubChem CID 135234015) has the molecular formula C48H34N2O and a molecular weight of 654.81 g/mol. Its IUPAC name is 2-[(1R)-cyclohexa-2,4-dien-1-yl]-4-[8-(4-phenanthren-2-ylphenyl)dibenzofuran-1-yl]-6-phenyl-1,4-dihydropyrimidine.
| Compound Name | 2-[(1R)-cyclohexa-2,4-dien-1-yl]-4-[8-(4-phenanthren-2-ylphenyl)dibenzofuran-1-yl]-6-phenyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 135234015 |
| Molecular Formula | C48H34N2O |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | 2-[(1R)-cyclohexa-2,4-dien-1-yl]-4-[8-(4-phenanthren-2-ylphenyl)dibenzofuran-1-yl]-6-phenyl-1,4-dihydropyrimidine |
| SMILES | C1=CC[C@@H](C2=NC(c3cccc4oc5ccc(-c6ccc(-c7ccc8c(ccc9ccccc98)c7)cc6)cc5c34)C=C(c3ccccc3)N2)C=C1 |
| InChI | InChI=1S/C48H34N2O/c1-3-11-34(12-4-1)43-30-44(50-48(49-43)35-13-5-2-6-14-35)41-16-9-17-46-47(41)42-29-37(25-27-45(42)51-46)32-20-18-31(19-21-32)36-24-26-40-38(28-36)23-22-33-10-7-8-15-39(33)40/h1-13,15-30,35,44H,14H2,(H,49,50)/t35-,44?/m0/s1 |
| InChIKey | FYHHRPZTLBQGOB-FZXGYKHYSA-N |
| XLogP | 12.44 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|