C36H30N2 — CID 170091618
2-cyclohexa-1,3-dien-1-yl-4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-phenanthren-2-yl-1,4-dihydropyrimidine (PubChem CID 170091618) has the molecular formula C36H30N2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-phenanthren-2-yl-1,4-dihydropyrimidine.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-phenanthren-2-yl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 170091618 |
| Molecular Formula | C36H30N2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-4-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-phenanthren-2-yl-1,4-dihydropyrimidine |
| SMILES | C1=CCCC(C2=NC(c3ccc(C4C=CC=CC4)cc3)C=C(c3ccc4c(ccc5ccccc54)c3)N2)=C1 |
| InChI | InChI=1S/C36H30N2/c1-3-9-25(10-4-1)26-15-18-28(19-16-26)34-24-35(38-36(37-34)29-12-5-2-6-13-29)31-21-22-33-30(23-31)20-17-27-11-7-8-14-32(27)33/h1-5,7-9,11-12,14-25,34H,6,10,13H2,(H,37,38) |
| InChIKey | JWLAWFQRNJAVGZ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|