C47H45N3 — CID 155274028
2-[4-[2-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-4-(4-phenanthren-9-ylphenyl)-1,4-dihydropyrimidin-6-yl]phenyl]pentan-1-imine (PubChem CID 155274028) has the molecular formula C47H45N3 and a molecular weight of 651.90 g/mol. Its IUPAC name is 2-[4-[2-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-4-(4-phenanthren-9-ylphenyl)-1,4-dihydropyrimidin-6-yl]phenyl]pentan-1-imine.
| Compound Name | 2-[4-[2-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-4-(4-phenanthren-9-ylphenyl)-1,4-dihydropyrimidin-6-yl]phenyl]pentan-1-imine |
|---|---|
| PubChem CID | 155274028 |
| Molecular Formula | C47H45N3 |
| Molecular Weight | 651.90 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | 2-[4-[2-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-4-(4-phenanthren-9-ylphenyl)-1,4-dihydropyrimidin-6-yl]phenyl]pentan-1-imine |
| SMILES | [H]/N=C/C(CCC)c1ccc(C2=CC(c3ccc(-c4cc5ccccc5c5ccccc45)cc3)N=C(C3=CC=C(C4CC=CCC4)CC3)N2)cc1 |
| InChI | InChI=1S/C47H45N3/c1-2-10-40(31-48)34-17-23-36(24-18-34)45-30-46(50-47(49-45)38-27-19-33(20-28-38)32-11-4-3-5-12-32)37-25-21-35(22-26-37)44-29-39-13-6-7-14-41(39)42-15-8-9-16-43(42)44/h3-4,6-9,13-19,21-27,29-32,40,46,48H,2,5,10-12,20,28H2,1H3,(H,49,50)/b48-31+ |
| InChIKey | CMTZQRGNHRTXQM-GKOACKCWSA-N |
| XLogP | 12.28 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.90 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|