C49H41N3 — CID 170094551
2-[3-(2,3-dihydrophenanthren-3-yl)-5-[4-(2,6-dimethyl-3-pyridinyl)cyclohexa-1,3-dien-1-yl]phenyl]-4,6-diphenyl-1,4-dihydropyrimidine (PubChem CID 170094551) has the molecular formula C49H41N3 and a molecular weight of 671.89 g/mol. Its IUPAC name is 2-[3-(2,3-dihydrophenanthren-3-yl)-5-[4-(2,6-dimethyl-3-pyridinyl)cyclohexa-1,3-dien-1-yl]phenyl]-4,6-diphenyl-1,4-dihydropyrimidine.
| Compound Name | 2-[3-(2,3-dihydrophenanthren-3-yl)-5-[4-(2,6-dimethyl-3-pyridinyl)cyclohexa-1,3-dien-1-yl]phenyl]-4,6-diphenyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 170094551 |
| Molecular Formula | C49H41N3 |
| Molecular Weight | 671.89 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | 2-[3-(2,3-dihydrophenanthren-3-yl)-5-[4-(2,6-dimethyl-3-pyridinyl)cyclohexa-1,3-dien-1-yl]phenyl]-4,6-diphenyl-1,4-dihydropyrimidine |
| SMILES | Cc1ccc(C2=CC=C(c3cc(C4=NC(c5ccccc5)C=C(c5ccccc5)N4)cc(C4C=c5c(ccc6ccccc56)=CC4)c3)CC2)c(C)n1 |
| InChI | InChI=1S/C49H41N3/c1-32-17-26-44(33(2)50-32)36-20-18-34(19-21-36)41-27-42(40-25-24-37-23-22-35-11-9-10-16-45(35)46(37)30-40)29-43(28-41)49-51-47(38-12-5-3-6-13-38)31-48(52-49)39-14-7-4-8-15-39/h3-18,20,22-24,26-31,40,47H,19,21,25H2,1-2H3,(H,51,52) |
| InChIKey | JKESWRVOCWVUTG-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.89 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |