C49H37N5O — CID 146246403
4-[2-[3-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)phenyl]-7,8-dihydrodibenzofuran-3-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 146246403) has the molecular formula C49H37N5O and a molecular weight of 711.87 g/mol. Its IUPAC name is 4-[2-[3-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)phenyl]-7,8-dihydrodibenzofuran-3-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[2-[3-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)phenyl]-7,8-dihydrodibenzofuran-3-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 146246403 |
| Molecular Formula | C49H37N5O |
| Molecular Weight | 711.87 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | 4-[2-[3-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)phenyl]-7,8-dihydrodibenzofuran-3-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=C(c2ccccc2)NC(c2cccc(-c3cc4c5c(oc4cc3C3N=C(c4ccccc4)NC(c4ccccc4)=N3)=CCCC=5)c2)=NC1c1ccccc1 |
| InChI | InChI=1S/C49H37N5O/c1-5-16-32(17-6-1)42-31-43(33-18-7-2-8-19-33)51-48(50-42)37-25-15-24-36(28-37)39-29-40-38-26-13-14-27-44(38)55-45(40)30-41(39)49-53-46(34-20-9-3-10-21-34)52-47(54-49)35-22-11-4-12-23-35/h1-12,15-31,42,49H,13-14H2,(H,50,51)(H,52,53,54) |
| InChIKey | CGBVYPFEPDWCQN-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.87 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |