C53H35N3O — CID 142343037
(4S)-4-(6,8-dinaphthalen-2-yldibenzofuran-1-yl)-2-phenyl-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine (PubChem CID 142343037) has the molecular formula C53H35N3O and a molecular weight of 729.88 g/mol. Its IUPAC name is (4S)-4-(6,8-dinaphthalen-2-yldibenzofuran-1-yl)-2-phenyl-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | (4S)-4-(6,8-dinaphthalen-2-yldibenzofuran-1-yl)-2-phenyl-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 142343037 |
| Molecular Formula | C53H35N3O |
| Molecular Weight | 729.88 g/mol |
| Exact Mass | 729.28 |
| IUPAC Name | (4S)-4-(6,8-dinaphthalen-2-yldibenzofuran-1-yl)-2-phenyl-6-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(C2=N[C@H](c3cccc4oc5c(-c6ccc7ccccc7c6)cc(-c6ccc7ccccc7c6)cc5c34)N=C(c3cccc(-c4ccccc4)c3)N2)cc1 |
| InChI | InChI=1S/C53H35N3O/c1-3-13-34(14-4-1)40-21-11-22-43(31-40)52-54-51(37-17-5-2-6-18-37)55-53(56-52)45-23-12-24-48-49(45)47-33-44(41-27-25-35-15-7-9-19-38(35)29-41)32-46(50(47)57-48)42-28-26-36-16-8-10-20-39(36)30-42/h1-33,53H,(H,54,55,56)/t53-/m0/s1 |
| InChIKey | LEYFIOGPJVNGCR-DTSDQNDWSA-N |
| XLogP | 13.39 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.88 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |