C51H35N3O — CID 167030009
2,6-bis(4-phenylphenyl)-4-[8-(4-phenylphenyl)dibenzofuran-1-yl]-1,4-dihydro-1,3,5-triazine (PubChem CID 167030009) has the molecular formula C51H35N3O and a molecular weight of 705.86 g/mol. Its IUPAC name is 2,6-bis(4-phenylphenyl)-4-[8-(4-phenylphenyl)dibenzofuran-1-yl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,6-bis(4-phenylphenyl)-4-[8-(4-phenylphenyl)dibenzofuran-1-yl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 167030009 |
| Molecular Formula | C51H35N3O |
| Molecular Weight | 705.86 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | 2,6-bis(4-phenylphenyl)-4-[8-(4-phenylphenyl)dibenzofuran-1-yl]-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(C3=NC(c4cccc5oc6ccc(-c7ccc(-c8ccccc8)cc7)cc6c45)N=C(c4ccc(-c5ccccc5)cc4)N3)cc2)cc1 |
| InChI | InChI=1S/C51H35N3O/c1-4-11-34(12-5-1)37-19-21-40(22-20-37)43-31-32-46-45(33-43)48-44(17-10-18-47(48)55-46)51-53-49(41-27-23-38(24-28-41)35-13-6-2-7-14-35)52-50(54-51)42-29-25-39(26-30-42)36-15-8-3-9-16-36/h1-33,51H,(H,52,53,54) |
| InChIKey | QRHYMBALYQKFOQ-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.86 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |