C51H37N3O — CID 134199439
4-[8-[5-(3,5-diphenylphenyl)cyclohexa-1,3-dien-1-yl]dibenzofuran-1-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 134199439) has the molecular formula C51H37N3O and a molecular weight of 707.88 g/mol. Its IUPAC name is 4-[8-[5-(3,5-diphenylphenyl)cyclohexa-1,3-dien-1-yl]dibenzofuran-1-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[8-[5-(3,5-diphenylphenyl)cyclohexa-1,3-dien-1-yl]dibenzofuran-1-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 134199439 |
| Molecular Formula | C51H37N3O |
| Molecular Weight | 707.88 g/mol |
| Exact Mass | 707.29 |
| IUPAC Name | 4-[8-[5-(3,5-diphenylphenyl)cyclohexa-1,3-dien-1-yl]dibenzofuran-1-yl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=CC(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)CC(c2ccc3oc4cccc(C5N=C(c6ccccc6)NC(c6ccccc6)=N5)c4c3c2)=C1 |
| InChI | InChI=1S/C51H37N3O/c1-5-15-34(16-6-1)41-30-42(35-17-7-2-8-18-35)32-43(31-41)39-24-13-23-38(29-39)40-27-28-46-45(33-40)48-44(25-14-26-47(48)55-46)51-53-49(36-19-9-3-10-20-36)52-50(54-51)37-21-11-4-12-22-37/h1-28,30-33,39,51H,29H2,(H,52,53,54) |
| InChIKey | CBNUXHJNYOARKY-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.88 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |