C7H16N2O — CID 135236045
2-N-(oxolan-2-yl)propane-1,2-diamine (PubChem CID 135236045) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is 2-N-(oxolan-2-yl)propane-1,2-diamine.
| Compound Name | 2-N-(oxolan-2-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 135236045 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 2-N-(oxolan-2-yl)propane-1,2-diamine |
| SMILES | CC(CN)NC1CCCO1 |
| InChI | InChI=1S/C7H16N2O/c1-6(5-8)9-7-3-2-4-10-7/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | AZWNWNRAHBDPCU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |