C8H15NO3 — CID 68789041
(2R)-2-(oxan-2-ylamino)propanoic acid (PubChem CID 68789041) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (2R)-2-(oxan-2-ylamino)propanoic acid.
| Compound Name | (2R)-2-(oxan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 68789041 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (2R)-2-(oxan-2-ylamino)propanoic acid |
| SMILES | C[C@@H](NC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-6(8(10)11)9-7-4-2-3-5-12-7/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7?/m1/s1 |
| InChIKey | HTCHPZDAWZATON-ULUSZKPHSA-N |
| XLogP | 0.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |