C30H44FN5O6 — CID 135236816
2-cyano-N-[2-[2-[[2-(2,2-dimethylpropanoylamino)-3-hydroxybutanoyl]amino]-3-[(2-fluoro-4-methylphenyl)methylamino]-3-oxopropoxy]ethyl]-N,4-dimethylpent-2-enamide (PubChem CID 135236816) has the molecular formula C30H44FN5O6 and a molecular weight of 589.71 g/mol. Its IUPAC name is 2-cyano-N-[2-[2-[[2-(2,2-dimethylpropanoylamino)-3-hydroxybutanoyl]amino]-3-[(2-fluoro-4-methylphenyl)methylamino]-3-oxopropoxy]ethyl]-N,4-dimethylpent-2-enamide.
| Compound Name | 2-cyano-N-[2-[2-[[2-(2,2-dimethylpropanoylamino)-3-hydroxybutanoyl]amino]-3-[(2-fluoro-4-methylphenyl)methylamino]-3-oxopropoxy]ethyl]-N,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 135236816 |
| Molecular Formula | C30H44FN5O6 |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.33 |
| IUPAC Name | 2-cyano-N-[2-[2-[[2-(2,2-dimethylpropanoylamino)-3-hydroxybutanoyl]amino]-3-[(2-fluoro-4-methylphenyl)methylamino]-3-oxopropoxy]ethyl]-N,4-dimethylpent-2-enamide |
| SMILES | Cc1ccc(CNC(=O)C(COCCN(C)C(=O)C(C#N)=CC(C)C)NC(=O)C(NC(=O)C(C)(C)C)C(C)O)c(F)c1 |
| InChI | InChI=1S/C30H44FN5O6/c1-18(2)13-22(15-32)28(40)36(8)11-12-42-17-24(26(38)33-16-21-10-9-19(3)14-23(21)31)34-27(39)25(20(4)37)35-29(41)30(5,6)7/h9-10,13-14,18,20,24-25,37H,11-12,16-17H2,1-8H3,(H,33,38)(H,34,39)(H,35,41) |
| InChIKey | SHVPGSZKEWZMMI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 160.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|