C30H43N5O5 — CID 118608025
2-cyano-N-[(5S)-5-[[(2S,3R)-3-hydroxy-2-(5-methyl-5H-1,2-oxazol-2-yl)butanoyl]amino]-6-[(4-methylphenyl)methylamino]-6-oxohexyl]-N,4-dimethylpent-2-enamide (PubChem CID 118608025) has the molecular formula C30H43N5O5 and a molecular weight of 553.70 g/mol. Its IUPAC name is 2-cyano-N-[(5S)-5-[[(2S,3R)-3-hydroxy-2-(5-methyl-5H-1,2-oxazol-2-yl)butanoyl]amino]-6-[(4-methylphenyl)methylamino]-6-oxohexyl]-N,4-dimethylpent-2-enamide.
| Compound Name | 2-cyano-N-[(5S)-5-[[(2S,3R)-3-hydroxy-2-(5-methyl-5H-1,2-oxazol-2-yl)butanoyl]amino]-6-[(4-methylphenyl)methylamino]-6-oxohexyl]-N,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 118608025 |
| Molecular Formula | C30H43N5O5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | 2-cyano-N-[(5S)-5-[[(2S,3R)-3-hydroxy-2-(5-methyl-5H-1,2-oxazol-2-yl)butanoyl]amino]-6-[(4-methylphenyl)methylamino]-6-oxohexyl]-N,4-dimethylpent-2-enamide |
| SMILES | Cc1ccc(CNC(=O)[C@H](CCCCN(C)C(=O)C(C#N)=CC(C)C)NC(=O)[C@H]([C@@H](C)O)N2C=CC(C)O2)cc1 |
| InChI | InChI=1S/C30H43N5O5/c1-20(2)17-25(18-31)30(39)34(6)15-8-7-9-26(28(37)32-19-24-12-10-21(3)11-13-24)33-29(38)27(23(5)36)35-16-14-22(4)40-35/h10-14,16-17,20,22-23,26-27,36H,7-9,15,19H2,1-6H3,(H,32,37)(H,33,38)/t22?,23-,26+,27+/m1/s1 |
| InChIKey | LNTJAHVNSYHOBU-QKGWXWKMSA-N |
| XLogP | 2.73 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|