C19H20ClF3N2O — CID 135237032
N-[(2-chlorophenyl)methyl]-N',N'-diethyl-2-(trifluoromethyl)benzohydrazide (PubChem CID 135237032) has the molecular formula C19H20ClF3N2O and a molecular weight of 384.83 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N',N'-diethyl-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N',N'-diethyl-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135237032 |
| Molecular Formula | C19H20ClF3N2O |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N',N'-diethyl-2-(trifluoromethyl)benzohydrazide |
| SMILES | CCN(CC)N(Cc1ccccc1Cl)C(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H20ClF3N2O/c1-3-24(4-2)25(13-14-9-5-8-12-17(14)20)18(26)15-10-6-7-11-16(15)19(21,22)23/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | MFKTYZGOYFIQFE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|