About [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid
[8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid (PubChem CID 135238379) has the molecular formula C15H21N3O7
and a molecular weight of 355.35 g/mol. Its IUPAC name is [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid.
Molecular Properties
| Compound Name | [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid |
| PubChem CID | 135238379 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid |
| SMILES | O=C(O)NCC1COC2(CCN(C(=O)ON3C(=O)CCC3=O)CC2)C1 |
| InChI | InChI=1S/C15H21N3O7/c19-11-1-2-12(20)18(11)25-14(23)17-5-3-15(4-6-17)7-10(9-24-15)8-16-13(21)22/h10,16H,1-9H2,(H,21,22) |
| InChIKey | AIEZPTGPVBXGTI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid?
The IUPAC name of [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid (CID 135238379) is [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid.
What is the SMILES notation for [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid?
The canonical SMILES for [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid is O=C(O)NCC1COC2(CCN(C(=O)ON3C(=O)CCC3=O)CC2)C1.
What is the InChIKey of [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid?
The InChIKey is AIEZPTGPVBXGTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O7/c19-11-1-2-12(20)18(11)25-14(23)17-5-3-15(4-6-17)7-10(9-24-15)8-16-13(21)22/h10,16H,1-9H2,(H,21,22).
What are the key properties of [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid?
[8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid has a molecular weight of 355.35 g/mol, XLogP of 0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-1-oxa-8-azaspiro[4.5]decan-3-yl]methylcarbamic acid is sourced from PubChem (CID 135238379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).