About 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile
4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile (PubChem CID 135241405) has the molecular formula C13H11BrN4
and a molecular weight of 303.16 g/mol. Its IUPAC name is 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile |
| PubChem CID | 135241405 |
| Molecular Formula | C13H11BrN4 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile |
| SMILES | N#CC1CC=C(c2nccn3ncc(Br)c23)CC1 |
| InChI | InChI=1S/C13H11BrN4/c14-11-8-17-18-6-5-16-12(13(11)18)10-3-1-9(7-15)2-4-10/h3,5-6,8-9H,1-2,4H2 |
| InChIKey | BDSYRLKMZKUANY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile?
The IUPAC name of 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile (CID 135241405) is 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile.
What is the SMILES notation for 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile?
The canonical SMILES for 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile is N#CC1CC=C(c2nccn3ncc(Br)c23)CC1.
What is the InChIKey of 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile?
The InChIKey is BDSYRLKMZKUANY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN4/c14-11-8-17-18-6-5-16-12(13(11)18)10-3-1-9(7-15)2-4-10/h3,5-6,8-9H,1-2,4H2.
What are the key properties of 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile?
4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile has a molecular weight of 303.16 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromopyrazolo[1,5-a]pyrazin-4-yl)cyclohex-3-ene-1-carbonitrile is sourced from PubChem (CID 135241405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).