C19H25BN4O2 — CID 140891398
4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]cyclohexane-1-carbonitrile (PubChem CID 140891398) has the molecular formula C19H25BN4O2 and a molecular weight of 352.25 g/mol. Its IUPAC name is 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 140891398 |
| Molecular Formula | C19H25BN4O2 |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]cyclohexane-1-carbonitrile |
| SMILES | CC1(C)OB(c2cnn3ccnc(C4CCC(C#N)CC4)c23)OC1(C)C |
| InChI | InChI=1S/C19H25BN4O2/c1-18(2)19(3,4)26-20(25-18)15-12-23-24-10-9-22-16(17(15)24)14-7-5-13(11-21)6-8-14/h9-10,12-14H,5-8H2,1-4H3 |
| InChIKey | SMIXRFNQUODNQW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|