C30H28N8O2 — CID 135241539
3-[6-[1-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-(2-phenoxyethylamino)pyrimidin-4-yl]benzonitrile (PubChem CID 135241539) has the molecular formula C30H28N8O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is 3-[6-[1-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-(2-phenoxyethylamino)pyrimidin-4-yl]benzonitrile.
| Compound Name | 3-[6-[1-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-(2-phenoxyethylamino)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 135241539 |
| Molecular Formula | C30H28N8O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 3-[6-[1-[[6-(1-methoxyethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-(2-phenoxyethylamino)pyrimidin-4-yl]benzonitrile |
| SMILES | COC(C)c1cccc(Cn2cc(-c3cc(-c4cccc(C#N)c4)nc(NCCOc4ccccc4)n3)nn2)n1 |
| InChI | InChI=1S/C30H28N8O2/c1-21(39-2)26-13-7-10-24(33-26)19-38-20-29(36-37-38)28-17-27(23-9-6-8-22(16-23)18-31)34-30(35-28)32-14-15-40-25-11-4-3-5-12-25/h3-13,16-17,20-21H,14-15,19H2,1-2H3,(H,32,34,35) |
| InChIKey | PYNMIJWAIKDCTM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|