C31H27N7O4 — CID 142404267
N-[6-(3-cyanophenyl)-4-[1-[[6-(dimethoxymethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-pyridinyl]-2-phenoxyacetamide (PubChem CID 142404267) has the molecular formula C31H27N7O4 and a molecular weight of 561.60 g/mol. Its IUPAC name is N-[6-(3-cyanophenyl)-4-[1-[[6-(dimethoxymethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-pyridinyl]-2-phenoxyacetamide.
| Compound Name | N-[6-(3-cyanophenyl)-4-[1-[[6-(dimethoxymethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-pyridinyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 142404267 |
| Molecular Formula | C31H27N7O4 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | N-[6-(3-cyanophenyl)-4-[1-[[6-(dimethoxymethyl)-2-pyridinyl]methyl]triazol-4-yl]-2-pyridinyl]-2-phenoxyacetamide |
| SMILES | COC(OC)c1cccc(Cn2cc(-c3cc(NC(=O)COc4ccccc4)nc(-c4cccc(C#N)c4)c3)nn2)n1 |
| InChI | InChI=1S/C31H27N7O4/c1-40-31(41-2)26-13-7-10-24(33-26)18-38-19-28(36-37-38)23-15-27(22-9-6-8-21(14-22)17-32)34-29(16-23)35-30(39)20-42-25-11-4-3-5-12-25/h3-16,19,31H,18,20H2,1-2H3,(H,34,35,39) |
| InChIKey | XXPPXOKEEOIZES-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|