C24H29F3N4O2 — CID 135243021
1-acetyl-1'-[[1-(4,4,4-trifluorobutyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one (PubChem CID 135243021) has the molecular formula C24H29F3N4O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 1-acetyl-1'-[[1-(4,4,4-trifluorobutyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one.
| Compound Name | 1-acetyl-1'-[[1-(4,4,4-trifluorobutyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 135243021 |
| Molecular Formula | C24H29F3N4O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-acetyl-1'-[[1-(4,4,4-trifluorobutyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one |
| SMILES | CC(=O)N1CC2(C1)C(=O)N(CC1=NC3CCCCC3N1CCCC(F)(F)F)c1ccccc12 |
| InChI | InChI=1S/C24H29F3N4O2/c1-16(32)29-14-23(15-29)17-7-2-4-9-19(17)31(22(23)33)13-21-28-18-8-3-5-10-20(18)30(21)12-6-11-24(25,26)27/h2,4,7,9,18,20H,3,5-6,8,10-15H2,1H3 |
| InChIKey | MFTYBJNJBOTVGM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |