C29H39N3O2 — CID 144858676
1-(2-cyclopentylbutanoyl)-1'-[2-(2-methylcyclohexen-1-yl)iminopropyl]spiro[azetidine-3,3'-indole]-2'-one (PubChem CID 144858676) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 1-(2-cyclopentylbutanoyl)-1'-[2-(2-methylcyclohexen-1-yl)iminopropyl]spiro[azetidine-3,3'-indole]-2'-one.
| Compound Name | 1-(2-cyclopentylbutanoyl)-1'-[2-(2-methylcyclohexen-1-yl)iminopropyl]spiro[azetidine-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 144858676 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 1-(2-cyclopentylbutanoyl)-1'-[2-(2-methylcyclohexen-1-yl)iminopropyl]spiro[azetidine-3,3'-indole]-2'-one |
| SMILES | CCC(C(=O)N1CC2(C1)C(=O)N(C/C(C)=N/C1=C(C)CCCC1)c1ccccc12)C1CCCC1 |
| InChI | InChI=1S/C29H39N3O2/c1-4-23(22-12-6-7-13-22)27(33)31-18-29(19-31)24-14-8-10-16-26(24)32(28(29)34)17-21(3)30-25-15-9-5-11-20(25)2/h8,10,14,16,22-23H,4-7,9,11-13,15,17-19H2,1-3H3/b30-21+ |
| InChIKey | ZZRTXAHELVIZSA-MWAVMZGNSA-N |
| XLogP | 5.64 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|