C29H39N3O4 — CID 122626302
propan-2-yl 1'-[8-hydroxy-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxylate (PubChem CID 122626302) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is propan-2-yl 1'-[8-hydroxy-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxylate.
| Compound Name | propan-2-yl 1'-[8-hydroxy-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 122626302 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | propan-2-yl 1'-[8-hydroxy-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]-2'-oxospiro[azetidine-3,3'-indole]-1-carboxylate |
| SMILES | C=C(CCCCO)C/C(CN1C(=O)C2(CN(C(=O)OC(C)C)C2)c2ccccc21)=N/C1=C(C)CCC1 |
| InChI | InChI=1S/C29H39N3O4/c1-20(2)36-28(35)31-18-29(19-31)24-12-5-6-14-26(24)32(27(29)34)17-23(16-21(3)10-7-8-15-33)30-25-13-9-11-22(25)4/h5-6,12,14,20,33H,3,7-11,13,15-19H2,1-2,4H3/b30-23- |
| InChIKey | MSCHVUHCHOLIDG-WMMMYUQOSA-N |
| XLogP | 5.14 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|