C28H36F3N3O2 — CID 122626276
1-[(1S)-1-methoxyethyl]-1'-[8,8,8-trifluoro-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]spiro[azetidine-3,3'-indole]-2'-one (PubChem CID 122626276) has the molecular formula C28H36F3N3O2 and a molecular weight of 503.61 g/mol. Its IUPAC name is 1-[(1S)-1-methoxyethyl]-1'-[8,8,8-trifluoro-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]spiro[azetidine-3,3'-indole]-2'-one.
| Compound Name | 1-[(1S)-1-methoxyethyl]-1'-[8,8,8-trifluoro-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]spiro[azetidine-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 122626276 |
| Molecular Formula | C28H36F3N3O2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 1-[(1S)-1-methoxyethyl]-1'-[8,8,8-trifluoro-2-(2-methylcyclopenten-1-yl)imino-4-methylideneoctyl]spiro[azetidine-3,3'-indole]-2'-one |
| SMILES | C=C(CCCC(F)(F)F)C/C(CN1C(=O)C2(CN([C@H](C)OC)C2)c2ccccc21)=N/C1=C(C)CCC1 |
| InChI | InChI=1S/C28H36F3N3O2/c1-19(9-8-14-28(29,30)31)15-22(32-24-12-7-10-20(24)2)16-34-25-13-6-5-11-23(25)27(26(34)35)17-33(18-27)21(3)36-4/h5-6,11,13,21H,1,7-10,12,14-18H2,2-4H3/b32-22-/t21-/m0/s1 |
| InChIKey | JDPQDCRDIXCCOD-PMWNKBIASA-N |
| XLogP | 6.16 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|