C20H25Cl2N3O2S — CID 135244941
N-[2-(2-aminoethoxy)ethyl]-3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfinamide (PubChem CID 135244941) has the molecular formula C20H25Cl2N3O2S and a molecular weight of 442.41 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfinamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 135244941 |
| Molecular Formula | C20H25Cl2N3O2S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfinamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2cccc(S(=O)NCCOCCN)c2)C1 |
| InChI | InChI=1S/C20H25Cl2N3O2S/c1-25-12-18(17-10-15(21)11-20(22)19(17)13-25)14-3-2-4-16(9-14)28(26)24-6-8-27-7-5-23/h2-4,9-11,18,24H,5-8,12-13,23H2,1H3 |
| InChIKey | YWVKPIPOIBHSTN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|