C38H28N4 — CID 135247205
2-[4-[1-[4-[(2Z,4Z)-hexa-2,4-dienyl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-2-yl]phenyl]benzonitrile (PubChem CID 135247205) has the molecular formula C38H28N4 and a molecular weight of 540.67 g/mol. Its IUPAC name is 2-[4-[1-[4-[(2Z,4Z)-hexa-2,4-dienyl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-2-yl]phenyl]benzonitrile.
| Compound Name | 2-[4-[1-[4-[(2Z,4Z)-hexa-2,4-dienyl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 135247205 |
| Molecular Formula | C38H28N4 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[4-[1-[4-[(2Z,4Z)-hexa-2,4-dienyl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-2-yl]phenyl]benzonitrile |
| SMILES | C/C=C\C=C/Cc1nc(-c2ccccc2)nc(-c2c(-c3ccc(-c4ccccc4C#N)cc3)ccc3ccccc23)n1 |
| InChI | InChI=1S/C38H28N4/c1-2-3-4-8-19-35-40-37(30-14-6-5-7-15-30)42-38(41-35)36-33-18-12-9-13-27(33)24-25-34(36)29-22-20-28(21-23-29)32-17-11-10-16-31(32)26-39/h2-18,20-25H,19H2,1H3/b3-2-,8-4- |
| InChIKey | QUUNYBNEKNQIGU-BGRWSDHPSA-N |
| XLogP | 9.24 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|