C15H15N — CID 135248198
N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3H-inden-4-amine (PubChem CID 135248198) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3H-inden-4-amine.
| Compound Name | N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3H-inden-4-amine |
|---|---|
| PubChem CID | 135248198 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3H-inden-4-amine |
| SMILES | C=C/C=C\C=C/Nc1cccc2c1CC=C2 |
| InChI | InChI=1S/C15H15N/c1-2-3-4-5-12-16-15-11-7-9-13-8-6-10-14(13)15/h2-9,11-12,16H,1,10H2/b4-3-,12-5- |
| InChIKey | GOOPLINDVMABPD-HVSXSXIDSA-N |
| XLogP | 3.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|