C11H13F2NO2S — CID 135248787
ethyl 3-(3-amino-2,6-difluorophenyl)sulfanylpropanoate (PubChem CID 135248787) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is ethyl 3-(3-amino-2,6-difluorophenyl)sulfanylpropanoate.
| Compound Name | ethyl 3-(3-amino-2,6-difluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 135248787 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethyl 3-(3-amino-2,6-difluorophenyl)sulfanylpropanoate |
| SMILES | CCOC(=O)CCSc1c(F)ccc(N)c1F |
| InChI | InChI=1S/C11H13F2NO2S/c1-2-16-9(15)5-6-17-11-7(12)3-4-8(14)10(11)13/h3-4H,2,5-6,14H2,1H3 |
| InChIKey | PTYVWGQXSHYVCJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|