C55H54N6 — CID 135250038
2-(2,4,4,5,5-pentamethylimidazol-1-yl)-5-[9-[6-(2,4,4,5,5-pentamethylimidazol-1-yl)-3-pyridinyl]-7,7-diphenylbenzo[c]fluoren-5-yl]pyridine (PubChem CID 135250038) has the molecular formula C55H54N6 and a molecular weight of 799.08 g/mol. Its IUPAC name is 2-(2,4,4,5,5-pentamethylimidazol-1-yl)-5-[9-[6-(2,4,4,5,5-pentamethylimidazol-1-yl)-3-pyridinyl]-7,7-diphenylbenzo[c]fluoren-5-yl]pyridine.
| Compound Name | 2-(2,4,4,5,5-pentamethylimidazol-1-yl)-5-[9-[6-(2,4,4,5,5-pentamethylimidazol-1-yl)-3-pyridinyl]-7,7-diphenylbenzo[c]fluoren-5-yl]pyridine |
|---|---|
| PubChem CID | 135250038 |
| Molecular Formula | C55H54N6 |
| Molecular Weight | 799.08 g/mol |
| Exact Mass | 798.44 |
| IUPAC Name | 2-(2,4,4,5,5-pentamethylimidazol-1-yl)-5-[9-[6-(2,4,4,5,5-pentamethylimidazol-1-yl)-3-pyridinyl]-7,7-diphenylbenzo[c]fluoren-5-yl]pyridine |
| SMILES | CC1=NC(C)(C)C(C)(C)N1c1ccc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(-c4ccc(N5C(C)=NC(C)(C)C5(C)C)nc4)c4ccccc4c2-3)cn1 |
| InChI | InChI=1S/C55H54N6/c1-35-58-51(3,4)53(7,8)60(35)48-29-26-38(33-56-48)37-25-28-44-46(31-37)55(40-19-13-11-14-20-40,41-21-15-12-16-22-41)47-32-45(42-23-17-18-24-43(42)50(44)47)39-27-30-49(57-34-39)61-36(2)59-52(5,6)54(61,9)10/h11-34H,1-10H3 |
| InChIKey | OHFZHLJMNZMGBO-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.08 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |