C57H56N4 — CID 135250416
2,4,4,5,5-pentamethyl-1-[4-[3-[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-11,11-diphenylbenzo[a]fluoren-9-yl]phenyl]imidazole (PubChem CID 135250416) has the molecular formula C57H56N4 and a molecular weight of 797.10 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethyl-1-[4-[3-[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-11,11-diphenylbenzo[a]fluoren-9-yl]phenyl]imidazole.
| Compound Name | 2,4,4,5,5-pentamethyl-1-[4-[3-[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-11,11-diphenylbenzo[a]fluoren-9-yl]phenyl]imidazole |
|---|---|
| PubChem CID | 135250416 |
| Molecular Formula | C57H56N4 |
| Molecular Weight | 797.10 g/mol |
| Exact Mass | 796.45 |
| IUPAC Name | 2,4,4,5,5-pentamethyl-1-[4-[3-[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-11,11-diphenylbenzo[a]fluoren-9-yl]phenyl]imidazole |
| SMILES | CC1=NC(C)(C)C(C)(C)N1c1ccc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2c-3ccc3cc(-c4ccc(N5C(C)=NC(C)(C)C5(C)C)cc4)ccc23)cc1 |
| InChI | InChI=1S/C57H56N4/c1-37-58-53(3,4)55(7,8)60(37)46-28-21-39(22-29-46)41-25-32-48-43(35-41)27-34-50-49-33-26-42(40-23-30-47(31-24-40)61-38(2)59-54(5,6)56(61,9)10)36-51(49)57(52(48)50,44-17-13-11-14-18-44)45-19-15-12-16-20-45/h11-36H,1-10H3 |
| InChIKey | HMNYGAXVXIPXAX-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.10 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |