C63H56N4 — CID 135249937
4,4,5,5-tetramethyl-1-phenyl-2-[3-[7'-[3-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]imidazole (PubChem CID 135249937) has the molecular formula C63H56N4 and a molecular weight of 869.17 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-1-phenyl-2-[3-[7'-[3-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]imidazole.
| Compound Name | 4,4,5,5-tetramethyl-1-phenyl-2-[3-[7'-[3-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]imidazole |
|---|---|
| PubChem CID | 135249937 |
| Molecular Formula | C63H56N4 |
| Molecular Weight | 869.17 g/mol |
| Exact Mass | 868.45 |
| IUPAC Name | 4,4,5,5-tetramethyl-1-phenyl-2-[3-[7'-[3-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]imidazole |
| SMILES | CC1(C)N=C(c2cccc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3cc(-c5cccc(C6=NC(C)(C)C(C)(C)N6c6ccccc6)c5)ccc3-4)c2)N(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C63H56N4/c1-59(2)61(5,6)66(47-25-11-9-12-26-47)57(64-59)45-23-19-21-41(37-45)43-33-35-51-52-36-34-44(40-56(52)63(55(51)39-43)53-31-17-15-29-49(53)50-30-16-18-32-54(50)63)42-22-20-24-46(38-42)58-65-60(3,4)62(7,8)67(58)48-27-13-10-14-28-48/h9-40H,1-8H3 |
| InChIKey | MYHXZHRGMOWDQH-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.17 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |