C56H54N4 — CID 135250550
4,4,5,5-tetramethyl-1-phenyl-2-[4-[3-(4-phenylphenyl)-5-[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]phenyl]phenyl]imidazole (PubChem CID 135250550) has the molecular formula C56H54N4 and a molecular weight of 783.08 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-1-phenyl-2-[4-[3-(4-phenylphenyl)-5-[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]phenyl]phenyl]imidazole.
| Compound Name | 4,4,5,5-tetramethyl-1-phenyl-2-[4-[3-(4-phenylphenyl)-5-[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]phenyl]phenyl]imidazole |
|---|---|
| PubChem CID | 135250550 |
| Molecular Formula | C56H54N4 |
| Molecular Weight | 783.08 g/mol |
| Exact Mass | 782.43 |
| IUPAC Name | 4,4,5,5-tetramethyl-1-phenyl-2-[4-[3-(4-phenylphenyl)-5-[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]phenyl]phenyl]imidazole |
| SMILES | CC1(C)N=C(c2ccc(-c3cc(-c4ccc(C5=NC(C)(C)C(C)(C)N5c5ccccc5)cc4)cc(-c4ccc(-c5ccccc5)cc4)c3)cc2)N(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C56H54N4/c1-53(2)55(5,6)59(49-20-14-10-15-21-49)51(57-53)44-32-28-42(29-33-44)47-36-46(41-26-24-40(25-27-41)39-18-12-9-13-19-39)37-48(38-47)43-30-34-45(35-31-43)52-58-54(3,4)56(7,8)60(52)50-22-16-11-17-23-50/h9-38H,1-8H3 |
| InChIKey | QVZFPXWXFWZBGE-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.08 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |