C46H50N4 — CID 135250554
2,4,4,5,5-pentamethyl-1-[3-[3-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-5-(3-phenylphenyl)phenyl]phenyl]imidazole (PubChem CID 135250554) has the molecular formula C46H50N4 and a molecular weight of 658.93 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethyl-1-[3-[3-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-5-(3-phenylphenyl)phenyl]phenyl]imidazole.
| Compound Name | 2,4,4,5,5-pentamethyl-1-[3-[3-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-5-(3-phenylphenyl)phenyl]phenyl]imidazole |
|---|---|
| PubChem CID | 135250554 |
| Molecular Formula | C46H50N4 |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.40 |
| IUPAC Name | 2,4,4,5,5-pentamethyl-1-[3-[3-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-5-(3-phenylphenyl)phenyl]phenyl]imidazole |
| SMILES | CC1=NC(C)(C)C(C)(C)N1c1cccc(-c2cc(-c3cccc(-c4ccccc4)c3)cc(-c3cccc(N4C(C)=NC(C)(C)C4(C)C)c3)c2)c1 |
| InChI | InChI=1S/C46H50N4/c1-31-47-43(3,4)45(7,8)49(31)41-23-15-21-36(29-41)39-26-38(35-20-14-19-34(25-35)33-17-12-11-13-18-33)27-40(28-39)37-22-16-24-42(30-37)50-32(2)48-44(5,6)46(50,9)10/h11-30H,1-10H3 |
| InChIKey | BREIOHCXYAKWNQ-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |