C54H52N6 — CID 135250598
2-(3-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]pyrimidine (PubChem CID 135250598) has the molecular formula C54H52N6 and a molecular weight of 785.05 g/mol. Its IUPAC name is 2-(3-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]pyrimidine.
| Compound Name | 2-(3-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 135250598 |
| Molecular Formula | C54H52N6 |
| Molecular Weight | 785.05 g/mol |
| Exact Mass | 784.43 |
| IUPAC Name | 2-(3-phenylphenyl)-4,6-bis[4-(4,4,5,5-tetramethyl-1-phenylimidazol-2-yl)phenyl]pyrimidine |
| SMILES | CC1(C)N=C(c2ccc(-c3cc(-c4ccc(C5=NC(C)(C)C(C)(C)N5c5ccccc5)cc4)nc(-c4cccc(-c5ccccc5)c4)n3)cc2)N(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C54H52N6/c1-51(2)53(5,6)59(44-23-14-10-15-24-44)49(57-51)40-31-27-38(28-32-40)46-36-47(56-48(55-46)43-22-18-21-42(35-43)37-19-12-9-13-20-37)39-29-33-41(34-30-39)50-58-52(3,4)54(7,8)60(50)45-25-16-11-17-26-45/h9-36H,1-8H3 |
| InChIKey | LCWDHSUSWBKMMZ-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.05 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |