C46H58N8 — CID 135250723
2,4,6-tris[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]pyrimidine (PubChem CID 135250723) has the molecular formula C46H58N8 and a molecular weight of 723.03 g/mol. Its IUPAC name is 2,4,6-tris[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]pyrimidine.
| Compound Name | 2,4,6-tris[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 135250723 |
| Molecular Formula | C46H58N8 |
| Molecular Weight | 723.03 g/mol |
| Exact Mass | 722.48 |
| IUPAC Name | 2,4,6-tris[4-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]pyrimidine |
| SMILES | CC1=NC(C)(C)C(C)(C)N1c1ccc(-c2cc(-c3ccc(N4C(C)=NC(C)(C)C4(C)C)cc3)nc(-c3ccc(N4C(C)=NC(C)(C)C4(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C46H58N8/c1-29-49-41(4,5)44(10,11)52(29)35-22-16-32(17-23-35)38-28-39(33-18-24-36(25-19-33)53-30(2)50-42(6,7)45(53,12)13)48-40(47-38)34-20-26-37(27-21-34)54-31(3)51-43(8,9)46(54,14)15/h16-28H,1-15H3 |
| InChIKey | GTFIBKBYAFSBDX-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 72.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.03 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |