C40H46N8S3 — CID 135250743
2-[6-[2,6-bis[5-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]pyrimidin-4-yl]-3-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole (PubChem CID 135250743) has the molecular formula C40H46N8S3 and a molecular weight of 735.07 g/mol. Its IUPAC name is 2-[6-[2,6-bis[5-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]pyrimidin-4-yl]-3-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole.
| Compound Name | 2-[6-[2,6-bis[5-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]pyrimidin-4-yl]-3-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole |
|---|---|
| PubChem CID | 135250743 |
| Molecular Formula | C40H46N8S3 |
| Molecular Weight | 735.07 g/mol |
| Exact Mass | 734.30 |
| IUPAC Name | 2-[6-[2,6-bis[5-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]pyrimidin-4-yl]-3-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole |
| SMILES | CC1(C)N=C(c2ccc(-c3cc(-c4ccc(C5=NC(C)(C)C(C)(C)S5)cn4)nc(-c4ccc(C5=NC(C)(C)C(C)(C)S5)cn4)n3)nc2)SC1(C)C |
| InChI | InChI=1S/C40H46N8S3/c1-35(2)38(7,8)49-32(46-35)23-13-16-26(41-20-23)29-19-30(27-17-14-24(21-42-27)33-47-36(3,4)39(9,10)50-33)45-31(44-29)28-18-15-25(22-43-28)34-48-37(5,6)40(11,12)51-34/h13-22H,1-12H3 |
| InChIKey | WVANIZBUDYYJSL-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.07 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |