C20H38O8 — CID 135253417
2-(5,6-dihydroxynonanoyloxy)ethyl 5,6-dihydroxynonanoate (PubChem CID 135253417) has the molecular formula C20H38O8 and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-(5,6-dihydroxynonanoyloxy)ethyl 5,6-dihydroxynonanoate.
| Compound Name | 2-(5,6-dihydroxynonanoyloxy)ethyl 5,6-dihydroxynonanoate |
|---|---|
| PubChem CID | 135253417 |
| Molecular Formula | C20H38O8 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-(5,6-dihydroxynonanoyloxy)ethyl 5,6-dihydroxynonanoate |
| SMILES | CCCC(O)C(O)CCCC(=O)OCCOC(=O)CCCC(O)C(O)CCC |
| InChI | InChI=1S/C20H38O8/c1-3-7-15(21)17(23)9-5-11-19(25)27-13-14-28-20(26)12-6-10-18(24)16(22)8-4-2/h15-18,21-24H,3-14H2,1-2H3 |
| InChIKey | YEXMKUGIBWOGBM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|