C44H24N6S2 — CID 135255603
2,6-bis(6-thiophen-2-ylindolo[2,3-b]indol-5-yl)benzene-1,4-dicarbonitrile (PubChem CID 135255603) has the molecular formula C44H24N6S2 and a molecular weight of 700.85 g/mol. Its IUPAC name is 2,6-bis(6-thiophen-2-ylindolo[2,3-b]indol-5-yl)benzene-1,4-dicarbonitrile.
| Compound Name | 2,6-bis(6-thiophen-2-ylindolo[2,3-b]indol-5-yl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 135255603 |
| Molecular Formula | C44H24N6S2 |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.15 |
| IUPAC Name | 2,6-bis(6-thiophen-2-ylindolo[2,3-b]indol-5-yl)benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3c4ccccc4n(-c4cccs4)c32)c(C#N)c(-n2c3ccccc3c3c4ccccc4n(-c4cccs4)c32)c1 |
| InChI | InChI=1S/C44H24N6S2/c45-25-27-23-37(47-33-15-5-1-11-28(33)41-30-13-3-7-17-35(30)49(43(41)47)39-19-9-21-51-39)32(26-46)38(24-27)48-34-16-6-2-12-29(34)42-31-14-4-8-18-36(31)50(44(42)48)40-20-10-22-52-40/h1-24H |
| InChIKey | ZGVKIXKESKUSJI-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 67.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |