C61H35N7 — CID 139538925
5-[4-cyano-3,5-bis[4-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile (PubChem CID 139538925) has the molecular formula C61H35N7 and a molecular weight of 866.00 g/mol. Its IUPAC name is 5-[4-cyano-3,5-bis[4-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-cyano-3,5-bis[4-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139538925 |
| Molecular Formula | C61H35N7 |
| Molecular Weight | 866.00 g/mol |
| Exact Mass | 865.30 |
| IUPAC Name | 5-[4-cyano-3,5-bis[4-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2cc(-n3c4ccccc4c4c(-c5cccc(-c6ccccc6)n5)cccc43)c(C#N)c(-n3c4ccccc4c4c(-c5cccc(-c6ccccc6)n5)cccc43)c2)c1 |
| InChI | InChI=1S/C61H35N7/c62-36-39-31-40(37-63)33-43(32-39)44-34-58(67-54-27-9-7-19-47(54)60-45(21-11-29-56(60)67)52-25-13-23-50(65-52)41-15-3-1-4-16-41)49(38-64)59(35-44)68-55-28-10-8-20-48(55)61-46(22-12-30-57(61)68)53-26-14-24-51(66-53)42-17-5-2-6-18-42/h1-35H |
| InChIKey | HIVCFCCKQJXFBX-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 107.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.00 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |