About diazinane-3,6-diamine
diazinane-3,6-diamine (PubChem CID 135257290) has the molecular formula C4H12N4
and a molecular weight of 116.17 g/mol. Its IUPAC name is diazinane-3,6-diamine.
Molecular Properties
| Compound Name | diazinane-3,6-diamine |
| PubChem CID | 135257290 |
| Molecular Formula | C4H12N4 |
| Molecular Weight | 116.17 g/mol |
| Exact Mass | 116.11 |
| IUPAC Name | diazinane-3,6-diamine |
| SMILES | NC1CCC(N)NN1 |
| InChI | InChI=1S/C4H12N4/c5-3-1-2-4(6)8-7-3/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | SAOULKHQZWMDLF-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.17 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze diazinane-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazinane-3,6-diamine?
The IUPAC name of diazinane-3,6-diamine (CID 135257290) is diazinane-3,6-diamine.
What is the SMILES notation for diazinane-3,6-diamine?
The canonical SMILES for diazinane-3,6-diamine is NC1CCC(N)NN1.
What is the InChIKey of diazinane-3,6-diamine?
The InChIKey is SAOULKHQZWMDLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N4/c5-3-1-2-4(6)8-7-3/h3-4,7-8H,1-2,5-6H2.
What are the key properties of diazinane-3,6-diamine?
diazinane-3,6-diamine has a molecular weight of 116.17 g/mol, XLogP of -1.56, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazinane-3,6-diamine is sourced from PubChem (CID 135257290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).