C5H12N4S — CID 139233727
6-propyl-1,2,4,5-tetrazinane-3-thione (PubChem CID 139233727) has the molecular formula C5H12N4S and a molecular weight of 160.25 g/mol. Its IUPAC name is 6-propyl-1,2,4,5-tetrazinane-3-thione.
| Compound Name | 6-propyl-1,2,4,5-tetrazinane-3-thione |
|---|---|
| PubChem CID | 139233727 |
| Molecular Formula | C5H12N4S |
| Molecular Weight | 160.25 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 6-propyl-1,2,4,5-tetrazinane-3-thione |
| SMILES | CCCC1NNC(=S)NN1 |
| InChI | InChI=1S/C5H12N4S/c1-2-3-4-6-8-5(10)9-7-4/h4,6-7H,2-3H2,1H3,(H2,8,9,10) |
| InChIKey | AVXUWIRTFVUSDH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|