C3H8N4S — CID 5062205
6-methyl-1,2,4,5-tetrazinane-3-thione (PubChem CID 5062205) has the molecular formula C3H8N4S and a molecular weight of 132.19 g/mol. Its IUPAC name is 6-methyl-1,2,4,5-tetrazinane-3-thione.
| Compound Name | 6-methyl-1,2,4,5-tetrazinane-3-thione |
|---|---|
| PubChem CID | 5062205 |
| Molecular Formula | C3H8N4S |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | 6-methyl-1,2,4,5-tetrazinane-3-thione |
| SMILES | CC1NNC(=S)NN1 |
| InChI | InChI=1S/C3H8N4S/c1-2-4-6-3(8)7-5-2/h2,4-5H,1H3,(H2,6,7,8) |
| InChIKey | BYIXAEICDPEBOP-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|