About propylaminothiourea
propylaminothiourea (PubChem CID 3374478) has the molecular formula C4H11N3S
and a molecular weight of 133.22 g/mol. Its IUPAC name is propylaminothiourea.
Molecular Properties
| Compound Name | propylaminothiourea |
| PubChem CID | 3374478 |
| Molecular Formula | C4H11N3S |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | propylaminothiourea |
| SMILES | CCCNNC(N)=S |
| InChI | InChI=1S/C4H11N3S/c1-2-3-6-7-4(5)8/h6H,2-3H2,1H3,(H3,5,7,8) |
| InChIKey | QEARVTSEDYKCLK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propylaminothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylaminothiourea?
The IUPAC name of propylaminothiourea (CID 3374478) is propylaminothiourea.
What is the SMILES notation for propylaminothiourea?
The canonical SMILES for propylaminothiourea is CCCNNC(N)=S.
What is the InChIKey of propylaminothiourea?
The InChIKey is QEARVTSEDYKCLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3S/c1-2-3-6-7-4(5)8/h6H,2-3H2,1H3,(H3,5,7,8).
What are the key properties of propylaminothiourea?
propylaminothiourea has a molecular weight of 133.22 g/mol, XLogP of -0.27, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propylaminothiourea is sourced from PubChem (CID 3374478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).