C4H10N4S — CID 3430095
6,6-dimethyl-1,2,4,5-tetrazinane-3-thione (PubChem CID 3430095) has the molecular formula C4H10N4S and a molecular weight of 146.22 g/mol. Its IUPAC name is 6,6-dimethyl-1,2,4,5-tetrazinane-3-thione.
| Compound Name | 6,6-dimethyl-1,2,4,5-tetrazinane-3-thione |
|---|---|
| PubChem CID | 3430095 |
| Molecular Formula | C4H10N4S |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 6,6-dimethyl-1,2,4,5-tetrazinane-3-thione |
| SMILES | CC1(C)NNC(=S)NN1 |
| InChI | InChI=1S/C4H10N4S/c1-4(2)7-5-3(9)6-8-4/h7-8H,1-2H3,(H2,5,6,9) |
| InChIKey | KMVDEJXQFPZXQA-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|