C6H7F5 — CID 135261919
1,1,4-trifluoro-2,3-bis(fluoromethyl)but-2-ene (PubChem CID 135261919) has the molecular formula C6H7F5 and a molecular weight of 174.11 g/mol. Its IUPAC name is 1,1,4-trifluoro-2,3-bis(fluoromethyl)but-2-ene.
| Compound Name | 1,1,4-trifluoro-2,3-bis(fluoromethyl)but-2-ene |
|---|---|
| PubChem CID | 135261919 |
| Molecular Formula | C6H7F5 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 1,1,4-trifluoro-2,3-bis(fluoromethyl)but-2-ene |
| SMILES | FCC(CF)=C(CF)C(F)F |
| InChI | InChI=1S/C6H7F5/c7-1-4(2-8)5(3-9)6(10)11/h6H,1-3H2 |
| InChIKey | XBABFTBTJCRMNA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|