C6H8F4 — CID 19819890
1,4-difluoro-2,3-bis(fluoromethyl)but-2-ene (PubChem CID 19819890) has the molecular formula C6H8F4 and a molecular weight of 156.12 g/mol. Its IUPAC name is 1,4-difluoro-2,3-bis(fluoromethyl)but-2-ene.
| Compound Name | 1,4-difluoro-2,3-bis(fluoromethyl)but-2-ene |
|---|---|
| PubChem CID | 19819890 |
| Molecular Formula | C6H8F4 |
| Molecular Weight | 156.12 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 1,4-difluoro-2,3-bis(fluoromethyl)but-2-ene |
| SMILES | FCC(CF)=C(CF)CF |
| InChI | InChI=1S/C6H8F4/c7-1-5(2-8)6(3-9)4-10/h1-4H2 |
| InChIKey | DBBKGLDDTOCIFV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.12 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|