C17H20BrNO5 — CID 135262021
4-[3-[(E)-1-bromo-4-methoxy-4-oxobut-2-en-2-yl]oxyphenyl]piperidine-1-carboxylic acid (PubChem CID 135262021) has the molecular formula C17H20BrNO5 and a molecular weight of 398.25 g/mol. Its IUPAC name is 4-[3-[(E)-1-bromo-4-methoxy-4-oxobut-2-en-2-yl]oxyphenyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[3-[(E)-1-bromo-4-methoxy-4-oxobut-2-en-2-yl]oxyphenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 135262021 |
| Molecular Formula | C17H20BrNO5 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 4-[3-[(E)-1-bromo-4-methoxy-4-oxobut-2-en-2-yl]oxyphenyl]piperidine-1-carboxylic acid |
| SMILES | COC(=O)/C=C(\CBr)Oc1cccc(C2CCN(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C17H20BrNO5/c1-23-16(20)10-15(11-18)24-14-4-2-3-13(9-14)12-5-7-19(8-6-12)17(21)22/h2-4,9-10,12H,5-8,11H2,1H3,(H,21,22)/b15-10+ |
| InChIKey | UXURYDJWZBKHFW-XNTDXEJSSA-N |
| XLogP | 3.37 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|