About (3-cyclopropylphenyl) carbamate
(3-cyclopropylphenyl) carbamate (PubChem CID 175067489) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is (3-cyclopropylphenyl) carbamate.
Molecular Properties
| Compound Name | (3-cyclopropylphenyl) carbamate |
| PubChem CID | 175067489 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3-cyclopropylphenyl) carbamate |
| SMILES | NC(=O)Oc1cccc(C2CC2)c1 |
| InChI | InChI=1S/C10H11NO2/c11-10(12)13-9-3-1-2-8(6-9)7-4-5-7/h1-3,6-7H,4-5H2,(H2,11,12) |
| InChIKey | OXRUKQZKJOGCQD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-cyclopropylphenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclopropylphenyl) carbamate?
The IUPAC name of (3-cyclopropylphenyl) carbamate (CID 175067489) is (3-cyclopropylphenyl) carbamate.
What is the SMILES notation for (3-cyclopropylphenyl) carbamate?
The canonical SMILES for (3-cyclopropylphenyl) carbamate is NC(=O)Oc1cccc(C2CC2)c1.
What is the InChIKey of (3-cyclopropylphenyl) carbamate?
The InChIKey is OXRUKQZKJOGCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c11-10(12)13-9-3-1-2-8(6-9)7-4-5-7/h1-3,6-7H,4-5H2,(H2,11,12).
What are the key properties of (3-cyclopropylphenyl) carbamate?
(3-cyclopropylphenyl) carbamate has a molecular weight of 177.20 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclopropylphenyl) carbamate is sourced from PubChem (CID 175067489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).