C13H17N3O3 — CID 139449180
(E)-2-amino-3-(3-cyclobutylphenoxy)-3-hydrazinylprop-2-enoic acid (PubChem CID 139449180) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is (E)-2-amino-3-(3-cyclobutylphenoxy)-3-hydrazinylprop-2-enoic acid.
| Compound Name | (E)-2-amino-3-(3-cyclobutylphenoxy)-3-hydrazinylprop-2-enoic acid |
|---|---|
| PubChem CID | 139449180 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (E)-2-amino-3-(3-cyclobutylphenoxy)-3-hydrazinylprop-2-enoic acid |
| SMILES | NN/C(Oc1cccc(C2CCC2)c1)=C(\N)C(=O)O |
| InChI | InChI=1S/C13H17N3O3/c14-11(13(17)18)12(16-15)19-10-6-2-5-9(7-10)8-3-1-4-8/h2,5-8,16H,1,3-4,14-15H2,(H,17,18)/b12-11+ |
| InChIKey | ZBPQFLKSQWSLIV-VAWYXSNFSA-N |
| XLogP | 1.01 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|