C23H33N3O4 — CID 135262488
tert-butyl 4-[5-methyl-1-(oxan-2-yl)-3-oxo-2H-indazol-6-yl]piperidine-1-carboxylate (PubChem CID 135262488) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl 4-[5-methyl-1-(oxan-2-yl)-3-oxo-2H-indazol-6-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-methyl-1-(oxan-2-yl)-3-oxo-2H-indazol-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135262488 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl 4-[5-methyl-1-(oxan-2-yl)-3-oxo-2H-indazol-6-yl]piperidine-1-carboxylate |
| SMILES | Cc1cc2c(=O)[nH]n(C3CCCCO3)c2cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H33N3O4/c1-15-13-18-19(26(24-21(18)27)20-7-5-6-12-29-20)14-17(15)16-8-10-25(11-9-16)22(28)30-23(2,3)4/h13-14,16,20H,5-12H2,1-4H3,(H,24,27) |
| InChIKey | VNCGJVJZLADOGV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |