About 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole
6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole (PubChem CID 135262520) has the molecular formula C13H16FN3
and a molecular weight of 233.29 g/mol. Its IUPAC name is 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole.
Molecular Properties
| Compound Name | 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole |
| PubChem CID | 135262520 |
| Molecular Formula | C13H16FN3 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole |
| SMILES | Cc1cc2cn[nH]c2cc1[C@H]1CCNC[C@H]1F |
| InChI | InChI=1S/C13H16FN3/c1-8-4-9-6-16-17-13(9)5-11(8)10-2-3-15-7-12(10)14/h4-6,10,12,15H,2-3,7H2,1H3,(H,16,17)/t10-,12-/m1/s1 |
| InChIKey | ZVROSSFBKKSLEA-ZYHUDNBSSA-N |
| XLogP | 2.29 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole?
The IUPAC name of 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole (CID 135262520) is 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole.
What is the SMILES notation for 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole?
The canonical SMILES for 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole is Cc1cc2cn[nH]c2cc1[C@H]1CCNC[C@H]1F.
What is the InChIKey of 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole?
The InChIKey is ZVROSSFBKKSLEA-ZYHUDNBSSA-N. The full InChI is InChI=1S/C13H16FN3/c1-8-4-9-6-16-17-13(9)5-11(8)10-2-3-15-7-12(10)14/h4-6,10,12,15H,2-3,7H2,1H3,(H,16,17)/t10-,12-/m1/s1.
What are the key properties of 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole?
6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole has a molecular weight of 233.29 g/mol, XLogP of 2.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3S,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-indazole is sourced from PubChem (CID 135262520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).