C22H31N3O — CID 146543957
6-[(4S)-6-[(2,4-dimethyl-3,6-dihydro-2H-pyran-6-yl)methyl]-4-methylpiperidin-3-yl]-5-methyl-1H-indazole (PubChem CID 146543957) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 6-[(4S)-6-[(2,4-dimethyl-3,6-dihydro-2H-pyran-6-yl)methyl]-4-methylpiperidin-3-yl]-5-methyl-1H-indazole.
| Compound Name | 6-[(4S)-6-[(2,4-dimethyl-3,6-dihydro-2H-pyran-6-yl)methyl]-4-methylpiperidin-3-yl]-5-methyl-1H-indazole |
|---|---|
| PubChem CID | 146543957 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 6-[(4S)-6-[(2,4-dimethyl-3,6-dihydro-2H-pyran-6-yl)methyl]-4-methylpiperidin-3-yl]-5-methyl-1H-indazole |
| SMILES | CC1=CC(CC2C[C@H](C)C(c3cc4[nH]ncc4cc3C)CN2)OC(C)C1 |
| InChI | InChI=1S/C22H31N3O/c1-13-5-16(4)26-19(6-13)9-18-8-15(3)21(12-23-18)20-10-22-17(7-14(20)2)11-24-25-22/h6-7,10-11,15-16,18-19,21,23H,5,8-9,12H2,1-4H3,(H,24,25)/t15-,16?,18?,19?,21?/m0/s1 |
| InChIKey | QPXFODHDZNECRR-IXEVRHSNSA-N |
| XLogP | 4.47 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|